Luteoline-7-glucoside: verschil tussen versies

Naar navigatie springen Naar zoeken springen
173 bytes verwijderd ,  14 jaar geleden
geen bewerkingssamenvatting
k (Bot: Wijziging Categorie:Benzeendiol)
Geen bewerkingssamenvatting
{{Infobox ChemischeStofTest
{{ChemischeStof|
| Naam = Luteoline-7-glucoside
| Afb1 = [[Afbeelding:Luteoline-7-glucoside.png|300px]]
| Afb4Omschr =
| Formule = C<sub>21</sub>H<sub>20</sub>O<sub>11</sub>
| SMILES = Zie voetnoot<ref>SMILES = c(c1)c(C(=C4)Oc(c3C(=O)4)cc(cc(O)3)O[C@H](O2)[C@@H](O)[C@@H](O)[C@@H](O)C2CO)cc(c(O)1)O<!--De Smiles specificatie maakte de infobox veel te breed en de specificatie bleek niet in te korten. Vandaar deze verplaatsing naar een voetnoot. --></ref>
| IUPAC = 2-(3,4-dihydroxyfenyl)-7-(β-D-glucopyranosyloxy)- 5-hydroxy-4H-1-benzopyran-4-on
| AndereNamen = cynaroside, cymaroside, glucoluteoline, 7-O-beta-D-Glucosyl-5,7,3',4'-tetrahydroxyflavon
| CAS = 5373-11-5
40.802

bewerkingen

Navigatiemenu